Source code for ase.atoms

# fmt: off

# Copyright 2008, 2009 CAMd
# (see accompanying license files for details).

"""Definition of the Atoms class.

This module defines the central object in the ASE package: the Atoms
object.
"""
from __future__ import annotations

import copy
import numbers
from math import cos, pi, sin
from typing import Sequence, Union, overload

import numpy as np

from ase import units
from ase.atom import Atom
from ase.cell import Cell
from ase.data import atomic_masses, atomic_masses_common
from ase.stress import full_3x3_to_voigt_6_stress, voigt_6_to_full_3x3_stress
from ase.symbols import Symbols, symbols2numbers
from ase.utils import deprecated, string2index


[docs] class Atoms: """Atoms object. The Atoms object can represent an isolated molecule, or a periodically repeated structure. It has a unit cell and there may be periodic boundary conditions along any of the three unit cell axes. Information about the atoms (atomic numbers and position) is stored in ndarrays. Optionally, there can be information about tags, momenta, masses, magnetic moments and charges. In order to calculate energies, forces and stresses, a calculator object has to attached to the atoms object. Parameters ---------- symbols : str | list[str] | list[Atom] Chemical formula, a list of chemical symbols, or list of :class:`~ase.Atom` objects (mutually exclusive with ``numbers``). - ``'H2O'`` - ``'COPt12'`` - ``['H', 'H', 'O']`` - ``[Atom('Ne', (x, y, z)), ...]`` positions : list[tuple[float, float, float]] Atomic positions in Cartesian coordinates (mutually exclusive with ``scaled_positions``). Anything that can be converted to an ndarray of shape (n, 3) works: [(x0, y0, z0), (x1, y1, z1), ...]. scaled_positions : list[tuple[float, float, float]] Atomic positions in units of the unit cell (mutually exclusive with ``positions``). numbers : list[int] Atomic numbers (mutually exclusive with ``symbols``). tags : list[int] Special purpose tags. momenta : list[tuple[float, float, float]] Momenta for all atoms in Cartesian coordinates (mutually exclusive with ``velocities``). velocities : list[tuple[float, float, float]] Velocities for all atoms in Cartesian coordinates (mutually exclusive with ``momenta``). masses : list[float] Atomic masses in atomic units. magmoms : list[float] | list[tuple[float, float, float]] Magnetic moments. Can be either a single value for each atom for collinear calculations or three numbers for each atom for non-collinear calculations. charges : list[float] Initial atomic charges. cell : 3x3 matrix or length 3 or 6 vector, default: (0, 0, 0) Unit cell vectors. Can also be given as just three numbers for orthorhombic cells, or 6 numbers, where first three are lengths of unit cell vectors, and the other three are angles between them (in degrees), in following order: [len(a), len(b), len(c), angle(b,c), angle(a,c), angle(a,b)]. First vector will lie in x-direction, second in xy-plane, and the third one in z-positive subspace. celldisp : tuple[float, float, float], default: (0, 0, 0) Unit cell displacement vector. To visualize a displaced cell around the center of mass of a Systems of atoms. pbc : bool | tuple[bool, bool, bool], default: False Periodic boundary conditions flags. - ``True`` - ``False`` - ``0`` - ``1`` - ``(1, 1, 0)`` - ``(True, False, False)`` constraint : constraint object(s) One or more ASE constraints applied during structure optimization. calculator : calculator object ASE calculator to obtain energies and atomic forces. info : dict | None, default: None Dictionary with additional information about the system. The following keys may be used by ASE: - spacegroup: :class:`~ase.spacegroup.Spacegroup` instance - unit_cell: 'conventional' | 'primitive' | int | 3 ints - adsorbate_info: Information about special adsorption sites Items in the info attribute survives copy and slicing and can be stored in and retrieved from trajectory files given that the key is a string, the value is JSON-compatible and, if the value is a user-defined object, its base class is importable. One should not make any assumptions about the existence of keys. Examples -------- >>> from ase import Atom N2 molecule (These three are equivalent): >>> d = 1.104 # N2 bondlength >>> a = Atoms('N2', [(0, 0, 0), (0, 0, d)]) >>> a = Atoms(numbers=[7, 7], positions=[(0, 0, 0), (0, 0, d)]) >>> a = Atoms([Atom('N', (0, 0, 0)), Atom('N', (0, 0, d))]) FCC gold: >>> a = 4.05 # Gold lattice constant >>> b = a / 2 >>> fcc = Atoms('Au', ... cell=[(0, b, b), (b, 0, b), (b, b, 0)], ... pbc=True) Hydrogen wire: >>> d = 0.9 # H-H distance >>> h = Atoms('H', positions=[(0, 0, 0)], ... cell=(d, 0, 0), ... pbc=(1, 0, 0)) """ ase_objtype = 'atoms' # For JSONability def __init__(self, symbols=None, positions=None, numbers=None, tags=None, momenta=None, masses=None, magmoms=None, charges=None, scaled_positions=None, cell=None, pbc=None, celldisp=None, constraint=None, calculator=None, info=None, velocities=None): self._cellobj = Cell.new() self._pbc = np.zeros(3, bool) atoms = None if hasattr(symbols, 'get_positions'): atoms = symbols symbols = None elif (isinstance(symbols, (list, tuple)) and len(symbols) > 0 and isinstance(symbols[0], Atom)): # Get data from a list or tuple of Atom objects: data = [[atom.get_raw(name) for atom in symbols] for name in ['position', 'number', 'tag', 'momentum', 'mass', 'magmom', 'charge']] atoms = self.__class__(None, *data) symbols = None if atoms is not None: # Get data from another Atoms object: if scaled_positions is not None: raise NotImplementedError if symbols is None and numbers is None: numbers = atoms.get_atomic_numbers() if positions is None: positions = atoms.get_positions() if tags is None and atoms.has('tags'): tags = atoms.get_tags() if momenta is None and atoms.has('momenta'): momenta = atoms.get_momenta() if magmoms is None and atoms.has('initial_magmoms'): magmoms = atoms.get_initial_magnetic_moments() if masses is None and atoms.has('masses'): masses = atoms.get_masses() if charges is None and atoms.has('initial_charges'): charges = atoms.get_initial_charges() if cell is None: cell = atoms.get_cell() if celldisp is None: celldisp = atoms.get_celldisp() if pbc is None: pbc = atoms.get_pbc() if constraint is None: constraint = [c.copy() for c in atoms.constraints] if calculator is None: calculator = atoms.calc if info is None: info = copy.deepcopy(atoms.info) self.arrays: dict[str, np.ndarray] = {} if symbols is not None and numbers is not None: raise TypeError('Use only one of "symbols" and "numbers".') if symbols is not None: numbers = symbols2numbers(symbols) elif numbers is None: if positions is not None: natoms = len(positions) elif scaled_positions is not None: natoms = len(scaled_positions) else: natoms = 0 numbers = np.zeros(natoms, int) self.new_array('numbers', numbers, int) if self.numbers.ndim != 1: raise ValueError('"numbers" must be 1-dimensional.') if cell is None: cell = np.zeros((3, 3)) self.set_cell(cell) if celldisp is None: celldisp = np.zeros(shape=(3, 1)) self.set_celldisp(celldisp) if positions is None: if scaled_positions is None: positions = np.zeros((len(self.arrays['numbers']), 3)) else: assert self.cell.rank == 3 positions = np.dot(scaled_positions, self.cell) else: if scaled_positions is not None: raise TypeError( 'Use only one of "positions" and "scaled_positions".') self.new_array('positions', positions, float, (3,)) self.set_constraint(constraint) self.set_tags(default(tags, 0)) self.set_masses(default(masses, None)) self.set_initial_magnetic_moments(default(magmoms, 0.0)) self.set_initial_charges(default(charges, 0.0)) if pbc is None: pbc = False self.set_pbc(pbc) self.set_momenta(default(momenta, (0.0, 0.0, 0.0)), apply_constraint=False) if velocities is not None: if momenta is None: self.set_velocities(velocities) else: raise TypeError( 'Use only one of "momenta" and "velocities".') if info is None: self.info = {} else: self.info = dict(info) self.calc = calculator @property def symbols(self): """Get chemical symbols as a :class:`ase.symbols.Symbols` object. The object works like ``atoms.numbers`` except its values are strings. It supports in-place editing.""" return Symbols(self.numbers) @symbols.setter def symbols(self, obj): new_symbols = Symbols.fromsymbols(obj) self.numbers[:] = new_symbols.numbers
[docs] def get_chemical_symbols(self): """Get list of chemical symbol strings. Equivalent to ``list(atoms.symbols)``.""" return list(self.symbols)
[docs] def set_chemical_symbols(self, symbols): """Set chemical symbols.""" self.set_array('numbers', symbols2numbers(symbols), int, ())
@property def numbers(self): """Attribute for direct manipulation of the atomic numbers.""" return self.arrays['numbers'] @numbers.setter def numbers(self, numbers): self.set_atomic_numbers(numbers)
[docs] def set_atomic_numbers(self, numbers): """Set atomic numbers.""" self.set_array('numbers', numbers, int, ())
[docs] def get_atomic_numbers(self): """Get integer array of atomic numbers.""" return self.arrays['numbers'].copy()
@property def positions(self): """Attribute for direct manipulation of the positions.""" return self.arrays['positions'] @positions.setter def positions(self, pos): self.arrays['positions'][:] = pos
[docs] def set_positions(self, newpositions, apply_constraint=True): """Set positions, honoring any constraints. To ignore constraints, use *apply_constraint=False*.""" if self.constraints and apply_constraint: newpositions = np.array(newpositions, float) for constraint in self.constraints: constraint.adjust_positions(self, newpositions) self.set_array('positions', newpositions, shape=(3,))
[docs] def get_positions(self, wrap=False, **wrap_kw): """Get array of positions. Parameters: wrap: bool wrap atoms back to the cell before returning positions wrap_kw: (keyword=value) pairs optional keywords `pbc`, `center`, `pretty_translation`, `eps`, see :func:`ase.geometry.wrap_positions` """ from ase.geometry import wrap_positions if wrap: if 'pbc' not in wrap_kw: wrap_kw['pbc'] = self.pbc return wrap_positions(self.positions, self.cell, **wrap_kw) else: return self.arrays['positions'].copy()
[docs] @deprecated("Please use atoms.calc = calc", FutureWarning) def set_calculator(self, calc=None): """Attach calculator object. .. deprecated:: 3.20.0 Please use the equivalent ``atoms.calc = calc`` instead of this method. """ self.calc = calc
[docs] @deprecated("Please use atoms.calc", FutureWarning) def get_calculator(self): """Get currently attached calculator object. .. deprecated:: 3.20.0 Please use the equivalent ``atoms.calc`` instead of ``atoms.get_calculator()``. """ return self.calc
@property def calc(self): """Calculator object.""" return self._calc @calc.setter def calc(self, calc): self._calc = calc if hasattr(calc, 'set_atoms'): calc.set_atoms(self) @calc.deleter @deprecated('Please use atoms.calc = None', FutureWarning) def calc(self): """Delete calculator .. deprecated:: 3.20.0 Please use ``atoms.calc = None`` """ self._calc = None @property @deprecated('Please use atoms.cell.rank instead', DeprecationWarning) def number_of_lattice_vectors(self): """Number of (non-zero) lattice vectors. .. deprecated:: 3.21.0 Please use ``atoms.cell.rank`` instead """ return self.cell.rank @property def constraints(self): return self._constraints @constraints.setter def constraints(self, constraint): self.set_constraint(constraint) @constraints.deleter def constraints(self): self._constraints = []
[docs] def set_constraint(self, constraint=None): """Apply one or more constrains. The *constraint* argument must be one constraint object or a list of constraint objects.""" if constraint is None: self._constraints = [] else: if isinstance(constraint, list): self._constraints = constraint elif isinstance(constraint, tuple): self._constraints = list(constraint) else: self._constraints = [constraint]
[docs] def get_number_of_degrees_of_freedom(self): """Calculate the number of degrees of freedom in the system.""" return len(self) * 3 - sum( c.get_removed_dof(self) for c in self._constraints )
[docs] def set_cell(self, cell, scale_atoms=False, apply_constraint=True): """Set unit cell vectors. Parameters: cell: 3x3 matrix or length 3 or 6 vector Unit cell. A 3x3 matrix (the three unit cell vectors) or just three numbers for an orthorhombic cell. Another option is 6 numbers, which describes unit cell with lengths of unit cell vectors and with angles between them (in degrees), in following order: [len(a), len(b), len(c), angle(b,c), angle(a,c), angle(a,b)]. First vector will lie in x-direction, second in xy-plane, and the third one in z-positive subspace. scale_atoms: bool Fix atomic positions or move atoms with the unit cell? Default behavior is to *not* move the atoms (scale_atoms=False). apply_constraint: bool Whether to apply constraints to the given cell. Examples: Two equivalent ways to define an orthorhombic cell: >>> atoms = Atoms('He') >>> a, b, c = 7, 7.5, 8 >>> atoms.set_cell([a, b, c]) >>> atoms.set_cell([(a, 0, 0), (0, b, 0), (0, 0, c)]) FCC unit cell: >>> atoms.set_cell([(0, b, b), (b, 0, b), (b, b, 0)]) Hexagonal unit cell: >>> atoms.set_cell([a, a, c, 90, 90, 120]) Rhombohedral unit cell: >>> alpha = 77 >>> atoms.set_cell([a, a, a, alpha, alpha, alpha]) """ # Override pbcs if and only if given a Cell object: cell = Cell.new(cell) # XXX not working well during initialize due to missing _constraints if apply_constraint and hasattr(self, '_constraints'): for constraint in self.constraints: if hasattr(constraint, 'adjust_cell'): constraint.adjust_cell(self, cell) if scale_atoms: M = np.linalg.solve(self.cell.complete(), cell.complete()) self.positions[:] = np.dot(self.positions, M) self.cell[:] = cell
[docs] def set_celldisp(self, celldisp): """Set the unit cell displacement vectors.""" celldisp = np.array(celldisp, float) self._celldisp = celldisp
[docs] def get_celldisp(self): """Get the unit cell displacement vectors.""" return self._celldisp.copy()
[docs] def get_cell(self, complete=False): """Get the three unit cell vectors as a `class`:ase.cell.Cell` object. The Cell object resembles a 3x3 ndarray, and cell[i, j] is the jth Cartesian coordinate of the ith cell vector.""" if complete: cell = self.cell.complete() else: cell = self.cell.copy() return cell
[docs] @deprecated('Please use atoms.cell.cellpar() instead', DeprecationWarning) def get_cell_lengths_and_angles(self): """Get unit cell parameters. Sequence of 6 numbers. First three are unit cell vector lengths and second three are angles between them:: [len(a), len(b), len(c), angle(b,c), angle(a,c), angle(a,b)] in degrees. .. deprecated:: 3.21.0 Please use ``atoms.cell.cellpar()`` instead """ return self.cell.cellpar()
[docs] @deprecated('Please use atoms.cell.reciprocal()', DeprecationWarning) def get_reciprocal_cell(self): """Get the three reciprocal lattice vectors as a 3x3 ndarray. Note that the commonly used factor of 2 pi for Fourier transforms is not included here. .. deprecated:: 3.21.0 Please use ``atoms.cell.reciprocal()`` """ return self.cell.reciprocal()
@property def pbc(self): """Reference to pbc-flags for in-place manipulations.""" return self._pbc @pbc.setter def pbc(self, pbc): self._pbc[:] = pbc
[docs] def set_pbc(self, pbc): """Set periodic boundary condition flags.""" self.pbc = pbc
[docs] def get_pbc(self): """Get periodic boundary condition flags.""" return self.pbc.copy()
[docs] def new_array(self, name, a, dtype=None, shape=None): """Add new array. If *shape* is not *None*, the shape of *a* will be checked.""" if dtype is not None: a = np.array(a, dtype, order='C') if len(a) == 0 and shape is not None: a.shape = (-1,) + shape else: if not a.flags['C_CONTIGUOUS']: a = np.ascontiguousarray(a) else: a = a.copy() if name in self.arrays: raise RuntimeError(f'Array {name} already present') for b in self.arrays.values(): if len(a) != len(b): raise ValueError('Array "%s" has wrong length: %d != %d.' % (name, len(a), len(b))) break if shape is not None and a.shape[1:] != shape: raise ValueError( f'Array "{name}" has wrong shape {a.shape} != ' f'{(a.shape[0:1] + shape)}.') self.arrays[name] = a
[docs] def get_array(self, name, copy=True): """Get an array. Returns a copy unless the optional argument copy is false. """ if copy: return self.arrays[name].copy() else: return self.arrays[name]
[docs] def set_array(self, name, a, dtype=None, shape=None): """Update array. If *shape* is not *None*, the shape of *a* will be checked. If *a* is *None*, then the array is deleted.""" b = self.arrays.get(name) if b is None: if a is not None: self.new_array(name, a, dtype, shape) else: if a is None: del self.arrays[name] else: a = np.asarray(a) if a.shape != b.shape: raise ValueError( f'Array "{name}" has wrong shape ' f'{a.shape} != {b.shape}.') b[:] = a
[docs] def has(self, name): """Check for existence of array. name must be one of: 'tags', 'momenta', 'masses', 'initial_magmoms', 'initial_charges'.""" # XXX extend has to calculator properties return name in self.arrays
[docs] def get_chemical_formula(self, mode='hill', empirical=False): """Get the chemical formula as a string based on the chemical symbols. Parameters: mode: str There are four different modes available: 'all': The list of chemical symbols are contracted to a string, e.g. ['C', 'H', 'H', 'H', 'O', 'H'] becomes 'CHHHOH'. 'reduce': The same as 'all' where repeated elements are contracted to a single symbol and a number, e.g. 'CHHHOCHHH' is reduced to 'CH3OCH3'. 'hill': The list of chemical symbols are contracted to a string following the Hill notation (alphabetical order with C and H first), e.g. 'CHHHOCHHH' is reduced to 'C2H6O' and 'SOOHOHO' to 'H2O4S'. This is default. 'metal': The list of chemical symbols (alphabetical metals, and alphabetical non-metals) empirical, bool (optional, default=False) Divide the symbol counts by their greatest common divisor to yield an empirical formula. Only for mode `metal` and `hill`. """ return self.symbols.get_chemical_formula(mode, empirical)
[docs] def set_tags(self, tags): """Set tags for all atoms. If only one tag is supplied, it is applied to all atoms.""" if isinstance(tags, int): tags = [tags] * len(self) self.set_array('tags', tags, int, ())
[docs] def get_tags(self): """Get integer array of tags.""" if 'tags' in self.arrays: return self.arrays['tags'].copy() else: return np.zeros(len(self), int)
[docs] def set_momenta(self, momenta, apply_constraint=True): """Set momenta.""" if (apply_constraint and len(self.constraints) > 0 and momenta is not None): momenta = np.array(momenta) # modify a copy for constraint in self.constraints: if hasattr(constraint, 'adjust_momenta'): constraint.adjust_momenta(self, momenta) self.set_array('momenta', momenta, float, (3,))
[docs] def get_momenta(self): """Get array of momenta.""" if 'momenta' in self.arrays: return self.arrays['momenta'].copy() else: return np.zeros((len(self), 3))
[docs] def get_velocities(self): """Get array of velocities.""" momenta = self.get_momenta() masses = self.get_masses() return momenta / masses[:, np.newaxis]
[docs] def set_velocities(self, velocities): """Set the momenta by specifying the velocities.""" self.set_momenta(self.get_masses()[:, np.newaxis] * velocities)
[docs] def set_masses(self, masses='defaults'): """Set atomic masses in atomic mass units. The array masses should contain a list of masses. In case the masses argument is not given or for those elements of the masses list that are None, standard values are set.""" if isinstance(masses, str): if masses == 'defaults': masses = atomic_masses[self.arrays['numbers']] elif masses == 'most_common': masses = atomic_masses_common[self.arrays['numbers']] elif masses is None: pass elif not isinstance(masses, np.ndarray): masses = list(masses) for i, mass in enumerate(masses): if mass is None: masses[i] = atomic_masses[self.numbers[i]] self.set_array('masses', masses, float, ())
[docs] def get_masses(self) -> np.ndarray: """Get masses of atoms. Returns ------- masses : np.ndarray Atomic masses in dalton (unified atomic mass units). Examples -------- >>> from ase.build import molecule >>> atoms = molecule('CH4') >>> atoms.get_masses() array([ 12.011, 1.008, 1.008, 1.008, 1.008]) >>> atoms.get_masses().sum() # total mass 16.042999999999996 """ if 'masses' in self.arrays: return self.arrays['masses'].copy() return atomic_masses[self.arrays['numbers']]
[docs] def set_initial_magnetic_moments(self, magmoms=None): """Set the initial magnetic moments. Use either one or three numbers for every atom (collinear or non-collinear spins).""" if magmoms is None: self.set_array('initial_magmoms', None) else: magmoms = np.asarray(magmoms) self.set_array('initial_magmoms', magmoms, float, magmoms.shape[1:])
[docs] def get_initial_magnetic_moments(self): """Get array of initial magnetic moments.""" if 'initial_magmoms' in self.arrays: return self.arrays['initial_magmoms'].copy() else: return np.zeros(len(self))
[docs] def get_magnetic_moments(self): """Get calculated local magnetic moments.""" if self._calc is None: raise RuntimeError('Atoms object has no calculator.') return self._calc.get_magnetic_moments(self)
[docs] def get_magnetic_moment(self): """Get calculated total magnetic moment.""" if self._calc is None: raise RuntimeError('Atoms object has no calculator.') return self._calc.get_magnetic_moment(self)
[docs] def set_initial_charges(self, charges=None): """Set the initial charges.""" if charges is None: self.set_array('initial_charges', None) else: self.set_array('initial_charges', charges, float, ())
[docs] def get_initial_charges(self): """Get array of initial charges.""" if 'initial_charges' in self.arrays: return self.arrays['initial_charges'].copy() else: return np.zeros(len(self))
[docs] def get_charges(self): """Get calculated charges.""" if self._calc is None: raise RuntimeError('Atoms object has no calculator.') try: return self._calc.get_charges(self) except AttributeError: from ase.calculators.calculator import PropertyNotImplementedError raise PropertyNotImplementedError
[docs] def get_potential_energy(self, force_consistent=False, apply_constraint=True): """Calculate potential energy. Ask the attached calculator to calculate the potential energy and apply constraints. Use *apply_constraint=False* to get the raw forces. When supported by the calculator, either the energy extrapolated to zero Kelvin or the energy consistent with the forces (the free energy) can be returned. """ if self._calc is None: raise RuntimeError('Atoms object has no calculator.') if force_consistent: energy = self._calc.get_potential_energy( self, force_consistent=force_consistent) else: energy = self._calc.get_potential_energy(self) if apply_constraint: for constraint in self.constraints: if hasattr(constraint, 'adjust_potential_energy'): energy += constraint.adjust_potential_energy(self) return energy
[docs] def get_properties(self, properties): """This method is experimental; currently for internal use.""" # XXX Something about constraints. if self._calc is None: raise RuntimeError('Atoms object has no calculator.') return self._calc.calculate_properties(self, properties)
[docs] def get_potential_energies(self): """Calculate the potential energies of all the atoms. Only available with calculators supporting per-atom energies (e.g. classical potentials). """ if self._calc is None: raise RuntimeError('Atoms object has no calculator.') return self._calc.get_potential_energies(self)
[docs] def get_kinetic_energy(self): """Get the kinetic energy.""" momenta = self.arrays.get('momenta') if momenta is None: return 0.0 return 0.5 * np.vdot(momenta, self.get_velocities())
[docs] def get_total_energy(self): """Get the total energy - potential plus kinetic energy.""" return self.get_potential_energy() + self.get_kinetic_energy()
[docs] def get_forces(self, apply_constraint=True, md=False): """Calculate atomic forces. Ask the attached calculator to calculate the forces and apply constraints. Use *apply_constraint=False* to get the raw forces. For molecular dynamics (md=True) we don't apply the constraint to the forces but to the momenta. When holonomic constraints for rigid linear triatomic molecules are present, ask the constraints to redistribute the forces within each triple defined in the constraints (required for molecular dynamics with this type of constraints).""" if self._calc is None: raise RuntimeError('Atoms object has no calculator.') forces = self._calc.get_forces(self) if apply_constraint: # We need a special md flag here because for MD we want # to skip real constraints but include special "constraints" # Like Hookean. for constraint in self.constraints: if md and hasattr(constraint, 'redistribute_forces_md'): constraint.redistribute_forces_md(self, forces) if not md or hasattr(constraint, 'adjust_potential_energy'): constraint.adjust_forces(self, forces) return forces
# Informs calculators (e.g. Asap) that ideal gas contribution is added here. _ase_handles_dynamic_stress = True
[docs] def get_stress(self, voigt=True, apply_constraint=True, include_ideal_gas=False): """Calculate stress tensor. Returns an array of the six independent components of the symmetric stress tensor, in the traditional Voigt order (xx, yy, zz, yz, xz, xy) or as a 3x3 matrix. Default is Voigt order. The ideal gas contribution to the stresses is added if the atoms have momenta and ``include_ideal_gas`` is set to True. """ if self._calc is None: raise RuntimeError('Atoms object has no calculator.') stress = self._calc.get_stress(self) shape = stress.shape if shape == (3, 3): # Convert to the Voigt form before possibly applying # constraints and adding the dynamic part of the stress # (the "ideal gas contribution"). stress = full_3x3_to_voigt_6_stress(stress) else: assert shape == (6,) if apply_constraint: for constraint in self.constraints: if hasattr(constraint, 'adjust_stress'): constraint.adjust_stress(self, stress) # Add ideal gas contribution, if applicable if include_ideal_gas and self.has('momenta'): stress += self.get_kinetic_stress() if voigt: return stress else: return voigt_6_to_full_3x3_stress(stress)
[docs] def get_stresses(self, include_ideal_gas=False, voigt=True): """Calculate the stress-tensor of all the atoms. Only available with calculators supporting per-atom energies and stresses (e.g. classical potentials). Even for such calculators there is a certain arbitrariness in defining per-atom stresses. The ideal gas contribution to the stresses is added if the atoms have momenta and ``include_ideal_gas`` is set to True. """ if self._calc is None: raise RuntimeError('Atoms object has no calculator.') stresses = self._calc.get_stresses(self) # make sure `stresses` are in voigt form if np.shape(stresses)[1:] == (3, 3): stresses_voigt = [full_3x3_to_voigt_6_stress(s) for s in stresses] stresses = np.array(stresses_voigt) # REMARK: The ideal gas contribution is intensive, i.e., the volume # is divided out. We currently don't check if `stresses` are intensive # as well, i.e., if `a.get_stresses.sum(axis=0) == a.get_stress()`. # It might be good to check this here, but adds computational overhead. if include_ideal_gas and self.has('momenta'): stresses += self.get_kinetic_stresses() if voigt: return stresses else: stresses_3x3 = [voigt_6_to_full_3x3_stress(s) for s in stresses] return np.array(stresses_3x3)
[docs] def get_kinetic_stress(self, voigt=True): """Calculate the kinetic part of the Virial stress tensor.""" stress = np.zeros(6) # Voigt notation stresscomp = np.array([[0, 5, 4], [5, 1, 3], [4, 3, 2]]) p = self.get_momenta() masses = self.get_masses() invmass = 1.0 / masses invvol = 1.0 / self.get_volume() for alpha in range(3): for beta in range(alpha, 3): stress[stresscomp[alpha, beta]] -= ( p[:, alpha] * p[:, beta] * invmass).sum() * invvol if voigt: return stress else: return voigt_6_to_full_3x3_stress(stress)
[docs] def get_kinetic_stresses(self, voigt=True): """Calculate the kinetic part of the Virial stress of all the atoms.""" stresses = np.zeros((len(self), 6)) # Voigt notation stresscomp = np.array([[0, 5, 4], [5, 1, 3], [4, 3, 2]]) if hasattr(self._calc, 'get_atomic_volumes'): invvol = 1.0 / self._calc.get_atomic_volumes() else: invvol = self.get_global_number_of_atoms() / self.get_volume() p = self.get_momenta() invmass = 1.0 / self.get_masses() for alpha in range(3): for beta in range(alpha, 3): stresses[:, stresscomp[alpha, beta]] -= ( p[:, alpha] * p[:, beta] * invmass * invvol) if voigt: return stresses else: stresses_3x3 = [voigt_6_to_full_3x3_stress(s) for s in stresses] return np.array(stresses_3x3)
[docs] def get_dipole_moment(self): """Calculate the electric dipole moment for the atoms object. Only available for calculators which has a get_dipole_moment() method.""" if self._calc is None: raise RuntimeError('Atoms object has no calculator.') return self._calc.get_dipole_moment(self)
[docs] def copy(self): """Return a copy.""" atoms = self.__class__(cell=self.cell, pbc=self.pbc, info=self.info, celldisp=self._celldisp.copy()) atoms.arrays = {} for name, a in self.arrays.items(): atoms.arrays[name] = a.copy() atoms.constraints = copy.deepcopy(self.constraints) return atoms
[docs] def todict(self): """For basic JSON (non-database) support.""" d = dict(self.arrays) d['cell'] = np.asarray(self.cell) d['pbc'] = self.pbc if self._celldisp.any(): d['celldisp'] = self._celldisp if self.constraints: d['constraints'] = self.constraints if self.info: d['info'] = self.info # Calculator... trouble. return d
[docs] @classmethod def fromdict(cls, dct): """Rebuild atoms object from dictionary representation (todict).""" dct = dct.copy() kw = {name: dct.pop(name) for name in ['numbers', 'positions', 'cell', 'pbc']} constraints = dct.pop('constraints', None) if constraints: from ase.constraints import dict2constraint constraints = [dict2constraint(d) for d in constraints] info = dct.pop('info', None) atoms = cls(constraint=constraints, celldisp=dct.pop('celldisp', None), info=info, **kw) natoms = len(atoms) # Some arrays are named differently from the atoms __init__ keywords. # Also, there may be custom arrays. Hence we set them directly: for name, arr in dct.items(): assert len(arr) == natoms, name assert isinstance(arr, np.ndarray) atoms.arrays[name] = arr return atoms
def __len__(self): return len(self.arrays['positions'])
[docs] @deprecated( "Please use len(self) or, if your atoms are distributed, " "self.get_global_number_of_atoms.", category=FutureWarning, ) def get_number_of_atoms(self): """ .. deprecated:: 3.18.1 You probably want ``len(atoms)``. Or if your atoms are distributed, use (and see) :func:`get_global_number_of_atoms()`. """ return len(self)
[docs] def get_global_number_of_atoms(self): """Returns the global number of atoms in a distributed-atoms parallel simulation. DO NOT USE UNLESS YOU KNOW WHAT YOU ARE DOING! Equivalent to len(atoms) in the standard ASE Atoms class. You should normally use len(atoms) instead. This function's only purpose is to make compatibility between ASE and Asap easier to maintain by having a few places in ASE use this function instead. It is typically only when counting the global number of degrees of freedom or in similar situations. """ return len(self)
def __repr__(self): tokens = [] N = len(self) if N <= 60: symbols = self.get_chemical_formula('reduce') else: symbols = self.get_chemical_formula('hill') tokens.append(f"symbols='{symbols}'") if self.pbc.any() and not self.pbc.all(): tokens.append(f'pbc={self.pbc.tolist()}') else: tokens.append(f'pbc={self.pbc[0]}') cell = self.cell if cell: if cell.orthorhombic: cell = cell.lengths().tolist() else: cell = cell.tolist() tokens.append(f'cell={cell}') for name in sorted(self.arrays): if name in ['numbers', 'positions']: continue tokens.append(f'{name}=...') if self.constraints: if len(self.constraints) == 1: constraint = self.constraints[0] else: constraint = self.constraints tokens.append(f'constraint={constraint!r}') if self._calc is not None: tokens.append('calculator={}(...)' .format(self._calc.__class__.__name__)) return '{}({})'.format(self.__class__.__name__, ', '.join(tokens)) def __add__(self, other): atoms = self.copy() atoms += other return atoms
[docs] def extend(self, other): """Extend atoms object by appending atoms from *other*.""" if isinstance(other, Atom): other = self.__class__([other]) n1 = len(self) n2 = len(other) for name, a1 in self.arrays.items(): a = np.zeros((n1 + n2,) + a1.shape[1:], a1.dtype) a[:n1] = a1 if name == 'masses': a2 = other.get_masses() else: a2 = other.arrays.get(name) if a2 is not None: a[n1:] = a2 self.arrays[name] = a for name, a2 in other.arrays.items(): if name in self.arrays: continue a = np.empty((n1 + n2,) + a2.shape[1:], a2.dtype) a[n1:] = a2 if name == 'masses': a[:n1] = self.get_masses()[:n1] else: a[:n1] = 0 self.set_array(name, a)
def __iadd__(self, other): self.extend(other) return self
[docs] def append(self, atom): """Append atom to end.""" self.extend(self.__class__([atom]))
def __iter__(self): for i in range(len(self)): yield self[i] @overload def __getitem__(self, i: Union[int, np.integer]) -> Atom: ... @overload def __getitem__(self, i: Union[Sequence, slice, np.ndarray]) -> Atoms: ... def __getitem__(self, i): """Return a subset of the atoms. i -- scalar integer, list of integers, or slice object describing which atoms to return. If i is a scalar, return an Atom object. If i is a list or a slice, return an Atoms object with the same cell, pbc, and other associated info as the original Atoms object. The indices of the constraints will be shuffled so that they match the indexing in the subset returned. """ if isinstance(i, numbers.Integral): natoms = len(self) if i < -natoms or i >= natoms: raise IndexError('Index out of range.') return Atom(atoms=self, index=i) elif not isinstance(i, slice): i = np.array(i) if len(i) == 0: i = np.array([], dtype=int) # if i is a mask if i.dtype == bool: if len(i) != len(self): raise IndexError('Length of mask {} must equal ' 'number of atoms {}' .format(len(i), len(self))) i = np.arange(len(self))[i] import copy conadd = [] # Constraints need to be deepcopied, but only the relevant ones. for con in copy.deepcopy(self.constraints): try: con.index_shuffle(self, i) except (IndexError, NotImplementedError): pass else: conadd.append(con) atoms = self.__class__(cell=self.cell, pbc=self.pbc, info=self.info, # should be communicated to the slice as well celldisp=self._celldisp) # TODO: Do we need to shuffle indices in adsorbate_info too? atoms.arrays = {} for name, a in self.arrays.items(): atoms.arrays[name] = a[i].copy() atoms.constraints = conadd return atoms def __delitem__(self, i): from ase.constraints import FixAtoms for c in self._constraints: if not isinstance(c, FixAtoms): raise RuntimeError('Remove constraint using set_constraint() ' 'before deleting atoms.') if isinstance(i, list) and len(i) > 0: # Make sure a list of booleans will work correctly and not be # interpreted at 0 and 1 indices. i = np.array(i) if len(self._constraints) > 0: n = len(self) i = np.arange(n)[i] if isinstance(i, int): i = [i] constraints = [] for c in self._constraints: c = c.delete_atoms(i, n) if c is not None: constraints.append(c) self.constraints = constraints mask = np.ones(len(self), bool) mask[i] = False for name, a in self.arrays.items(): self.arrays[name] = a[mask]
[docs] def pop(self, i=-1): """Remove and return atom at index *i* (default last).""" atom = self[i] atom.cut_reference_to_atoms() del self[i] return atom
def __imul__(self, m): """In-place repeat of atoms.""" if isinstance(m, int): m = (m, m, m) for x, vec in zip(m, self.cell): if x != 1 and not vec.any(): raise ValueError('Cannot repeat along undefined lattice ' 'vector') M = np.prod(m) n = len(self) for name, a in self.arrays.items(): self.arrays[name] = np.tile(a, (M,) + (1,) * (len(a.shape) - 1)) positions = self.arrays['positions'] i0 = 0 for m0 in range(m[0]): for m1 in range(m[1]): for m2 in range(m[2]): i1 = i0 + n positions[i0:i1] += np.dot((m0, m1, m2), self.cell) i0 = i1 if self.constraints is not None: self.constraints = [c.repeat(m, n) for c in self.constraints] self.cell = np.array([m[c] * self.cell[c] for c in range(3)]) return self
[docs] def repeat(self, rep): """Create new repeated atoms object. The *rep* argument should be a sequence of three positive integers like *(2,3,1)* or a single integer (*r*) equivalent to *(r,r,r)*.""" atoms = self.copy() atoms *= rep return atoms
def __mul__(self, rep): return self.repeat(rep)
[docs] def translate(self, displacement): """Translate atomic positions. The displacement argument can be a float an xyz vector or an nx3 array (where n is the number of atoms).""" self.arrays['positions'] += np.array(displacement)
[docs] def center(self, vacuum=None, axis=(0, 1, 2), about=None): """Center atoms in unit cell. Centers the atoms in the unit cell, so there is the same amount of vacuum on all sides. vacuum: float (default: None) If specified adjust the amount of vacuum when centering. If vacuum=10.0 there will thus be 10 Angstrom of vacuum on each side. axis: int or sequence of ints Axis or axes to act on. Default: Act on all axes. about: float or array (default: None) If specified, center the atoms about <about>. I.e., about=(0., 0., 0.) (or just "about=0.", interpreted identically), to center about the origin. """ # Find the orientations of the faces of the unit cell cell = self.cell.complete() dirs = np.zeros_like(cell) lengths = cell.lengths() for i in range(3): dirs[i] = np.cross(cell[i - 1], cell[i - 2]) dirs[i] /= np.linalg.norm(dirs[i]) if dirs[i] @ cell[i] < 0.0: dirs[i] *= -1 if isinstance(axis, int): axes = (axis,) else: axes = axis # Now, decide how much each basis vector should be made longer pos = self.positions longer = np.zeros(3) shift = np.zeros(3) for i in axes: if len(pos): scalarprod = pos @ dirs[i] p0 = scalarprod.min() p1 = scalarprod.max() else: p0 = 0 p1 = 0 height = cell[i] @ dirs[i] if vacuum is not None: lng = (p1 - p0 + 2 * vacuum) - height else: lng = 0.0 # Do not change unit cell size! top = lng + height - p1 shf = 0.5 * (top - p0) cosphi = cell[i] @ dirs[i] / lengths[i] longer[i] = lng / cosphi shift[i] = shf / cosphi # Now, do it! translation = np.zeros(3) for i in axes: nowlen = lengths[i] if vacuum is not None: self.cell[i] = cell[i] * (1 + longer[i] / nowlen) translation += shift[i] * cell[i] / nowlen # We calculated translations using the completed cell, # so directions without cell vectors will have been centered # along a "fake" vector of length 1. # Therefore, we adjust by -0.5: if not any(self.cell[i]): translation[i] -= 0.5 # Optionally, translate to center about a point in space. if about is not None: for n, vector in enumerate(self.cell): if n in axes: translation -= vector / 2.0 translation[n] += about[n] self.positions += translation
[docs] def get_center_of_mass(self, scaled=False, indices=None): """Get the center of mass. Parameters ---------- scaled : bool If True, the center of mass in scaled coordinates is returned. indices : list | slice | str, default: None If specified, the center of mass of a subset of atoms is returned. """ if indices is None: indices = slice(None) elif isinstance(indices, str): indices = string2index(indices) masses = self.get_masses()[indices] com = masses @ self.positions[indices] / masses.sum() if scaled: return self.cell.scaled_positions(com) return com # Cartesian coordinates
[docs] def set_center_of_mass(self, com, scaled=False): """Set the center of mass. If scaled=True the center of mass is expected in scaled coordinates. Constraints are considered for scaled=False. """ old_com = self.get_center_of_mass(scaled=scaled) difference = com - old_com if scaled: self.set_scaled_positions(self.get_scaled_positions() + difference) else: self.set_positions(self.get_positions() + difference)
[docs] def get_moments_of_inertia(self, vectors=False): """Get the moments of inertia along the principal axes. The three principal moments of inertia are computed from the eigenvalues of the symmetric inertial tensor. Periodic boundary conditions are ignored. Units of the moments of inertia are amu*angstrom**2. """ com = self.get_center_of_mass() positions = self.get_positions() positions -= com # translate center of mass to origin masses = self.get_masses() # Initialize elements of the inertial tensor I11 = I22 = I33 = I12 = I13 = I23 = 0.0 for i in range(len(self)): x, y, z = positions[i] m = masses[i] I11 += m * (y ** 2 + z ** 2) I22 += m * (x ** 2 + z ** 2) I33 += m * (x ** 2 + y ** 2) I12 += -m * x * y I13 += -m * x * z I23 += -m * y * z Itensor = np.array([[I11, I12, I13], [I12, I22, I23], [I13, I23, I33]]) evals, evecs = np.linalg.eigh(Itensor) if vectors: return evals, evecs.transpose() else: return evals
[docs] def get_angular_momentum(self): """Get total angular momentum with respect to the center of mass.""" com = self.get_center_of_mass() positions = self.get_positions() positions -= com # translate center of mass to origin return np.cross(positions, self.get_momenta()).sum(0)
[docs] def rotate(self, a, v, center=(0, 0, 0), rotate_cell=False): """Rotate atoms based on a vector and an angle, or two vectors. Parameters: a = None: Angle that the atoms is rotated around the vector 'v'. 'a' can also be a vector and then 'a' is rotated into 'v'. v: Vector to rotate the atoms around. Vectors can be given as strings: 'x', '-x', 'y', ... . center = (0, 0, 0): The center is kept fixed under the rotation. Use 'COM' to fix the center of mass, 'COP' to fix the center of positions or 'COU' to fix the center of cell. rotate_cell = False: If true the cell is also rotated. Examples: Rotate 90 degrees around the z-axis, so that the x-axis is rotated into the y-axis: >>> atoms = Atoms() >>> atoms.rotate(90, 'z') >>> atoms.rotate(90, (0, 0, 1)) >>> atoms.rotate(-90, '-z') >>> atoms.rotate('x', 'y') >>> atoms.rotate((1, 0, 0), (0, 1, 0)) """ if not isinstance(a, numbers.Real): a, v = v, a norm = np.linalg.norm v = string2vector(v) normv = norm(v) if normv == 0.0: raise ZeroDivisionError('Cannot rotate: norm(v) == 0') if isinstance(a, numbers.Real): a *= pi / 180 v /= normv c = cos(a) s = sin(a) else: v2 = string2vector(a) v /= normv normv2 = np.linalg.norm(v2) if normv2 == 0: raise ZeroDivisionError('Cannot rotate: norm(a) == 0') v2 /= norm(v2) c = np.dot(v, v2) v = np.cross(v, v2) s = norm(v) # In case *v* and *a* are parallel, np.cross(v, v2) vanish # and can't be used as a rotation axis. However, in this # case any rotation axis perpendicular to v2 will do. eps = 1e-7 if s < eps: v = np.cross((0, 0, 1), v2) if norm(v) < eps: v = np.cross((1, 0, 0), v2) assert norm(v) >= eps elif s > 0: v /= s center = self._centering_as_array(center) p = self.arrays['positions'] - center self.arrays['positions'][:] = (c * p - np.cross(p, s * v) + np.outer(np.dot(p, v), (1.0 - c) * v) + center) if rotate_cell: rotcell = self.get_cell() rotcell[:] = (c * rotcell - np.cross(rotcell, s * v) + np.outer(np.dot(rotcell, v), (1.0 - c) * v)) self.set_cell(rotcell)
def _centering_as_array(self, center): if isinstance(center, str): if center.lower() == 'com': center = self.get_center_of_mass() elif center.lower() == 'cop': center = self.get_positions().mean(axis=0) elif center.lower() == 'cou': center = self.get_cell().sum(axis=0) / 2 else: raise ValueError('Cannot interpret center') else: center = np.array(center, float) return center
[docs] def euler_rotate( self, phi: float = 0.0, theta: float = 0.0, psi: float = 0.0, center: Sequence[float] = (0.0, 0.0, 0.0), ) -> None: """Rotate atoms via Euler angles (in degrees). See e.g http://mathworld.wolfram.com/EulerAngles.html for explanation. Note that the rotations in this method are passive and applied **not** to the atomic coordinates in the present frame **but** the frame itself. Parameters ---------- phi : float The 1st rotation angle around the z axis. theta : float Rotation around the x axis. psi : float 2nd rotation around the z axis. center : Sequence[float], default = (0.0, 0.0, 0.0) The point to rotate about. A sequence of length 3 with the coordinates, or 'COM' to select the center of mass, 'COP' to select center of positions or 'COU' to select center of cell. """ from scipy.spatial.transform import Rotation as R center = self._centering_as_array(center) # passive rotations (negative angles) for backward compatibility rotation = R.from_euler('zxz', (-phi, -theta, -psi), degrees=True) self.positions = rotation.apply(self.positions - center) + center
[docs] def get_dihedral(self, a0, a1, a2, a3, mic=False): """Calculate dihedral angle. Calculate dihedral angle (in degrees) between the vectors a0->a1 and a2->a3. Use mic=True to use the Minimum Image Convention and calculate the angle across periodic boundaries. """ return self.get_dihedrals([[a0, a1, a2, a3]], mic=mic)[0]
[docs] def get_dihedrals(self, indices, mic=False): """Calculate dihedral angles. Calculate dihedral angles (in degrees) between the list of vectors a0->a1 and a2->a3, where a0, a1, a2 and a3 are in each row of indices. Use mic=True to use the Minimum Image Convention and calculate the angles across periodic boundaries. """ from ase.geometry import get_dihedrals indices = np.array(indices) assert indices.shape[1] == 4 a0s = self.positions[indices[:, 0]] a1s = self.positions[indices[:, 1]] a2s = self.positions[indices[:, 2]] a3s = self.positions[indices[:, 3]] # vectors 0->1, 1->2, 2->3 v0 = a1s - a0s v1 = a2s - a1s v2 = a3s - a2s cell = None pbc = None if mic: cell = self.cell pbc = self.pbc return get_dihedrals(v0, v1, v2, cell=cell, pbc=pbc)
def _masked_rotate(self, center, axis, diff, mask): # do rotation of subgroup by copying it to temporary atoms object # and then rotating that # # recursive object definition might not be the most elegant thing, # more generally useful might be a rotation function with a mask? group = self.__class__() for i in range(len(self)): if mask[i]: group += self[i] group.translate(-center) group.rotate(diff * 180 / pi, axis) group.translate(center) # set positions in original atoms object j = 0 for i in range(len(self)): if mask[i]: self.positions[i] = group[j].position j += 1
[docs] def set_dihedral(self, a1, a2, a3, a4, angle, mask=None, indices=None): """Set the dihedral angle (degrees) between vectors a1->a2 and a3->a4 by changing the atom indexed by a4. If mask is not None, all the atoms described in mask (read: the entire subgroup) are moved. Alternatively to the mask, the indices of the atoms to be rotated can be supplied. If both *mask* and *indices* are given, *indices* overwrites *mask*. **Important**: If *mask* or *indices* is given and does not contain *a4*, *a4* will NOT be moved. In most cases you therefore want to include *a4* in *mask*/*indices*. Example: the following defines a very crude ethane-like molecule and twists one half of it by 30 degrees. >>> atoms = Atoms('HHCCHH', [[-1, 1, 0], [-1, -1, 0], [0, 0, 0], ... [1, 0, 0], [2, 1, 0], [2, -1, 0]]) >>> atoms.set_dihedral(1, 2, 3, 4, 210, mask=[0, 0, 0, 1, 1, 1]) """ angle *= pi / 180 # if not provided, set mask to the last atom in the # dihedral description if mask is None and indices is None: mask = np.zeros(len(self)) mask[a4] = 1 elif indices is not None: mask = [index in indices for index in range(len(self))] # compute necessary in dihedral change, from current value current = self.get_dihedral(a1, a2, a3, a4) * pi / 180 diff = angle - current axis = self.positions[a3] - self.positions[a2] center = self.positions[a3] self._masked_rotate(center, axis, diff, mask)
[docs] def rotate_dihedral(self, a1, a2, a3, a4, angle, mask=None, indices=None): """Rotate dihedral angle. Same usage as in :meth:`ase.Atoms.set_dihedral`: Rotate a group by a predefined dihedral angle, starting from its current configuration. """ start = self.get_dihedral(a1, a2, a3, a4) self.set_dihedral(a1, a2, a3, a4, angle + start, mask, indices)
[docs] def get_angle(self, a1, a2, a3, mic=False): """Get angle formed by three atoms. Calculate angle in degrees between the vectors a2->a1 and a2->a3. Use mic=True to use the Minimum Image Convention and calculate the angle across periodic boundaries. """ return self.get_angles([[a1, a2, a3]], mic=mic)[0]
[docs] def get_angles(self, indices, mic=False): """Get angle formed by three atoms for multiple groupings. Calculate angle in degrees between vectors between atoms a2->a1 and a2->a3, where a1, a2, and a3 are in each row of indices. Use mic=True to use the Minimum Image Convention and calculate the angle across periodic boundaries. """ from ase.geometry import get_angles indices = np.array(indices) assert indices.shape[1] == 3 a1s = self.positions[indices[:, 0]] a2s = self.positions[indices[:, 1]] a3s = self.positions[indices[:, 2]] v12 = a1s - a2s v32 = a3s - a2s cell = None pbc = None if mic: cell = self.cell pbc = self.pbc return get_angles(v12, v32, cell=cell, pbc=pbc)
[docs] def set_angle(self, a1, a2=None, a3=None, angle=None, mask=None, indices=None, add=False): """Set angle (in degrees) formed by three atoms. Sets the angle between vectors *a2*->*a1* and *a2*->*a3*. If *add* is `True`, the angle will be changed by the value given. Same usage as in :meth:`ase.Atoms.set_dihedral`. If *mask* and *indices* are given, *indices* overwrites *mask*. If *mask* and *indices* are not set, only *a3* is moved.""" if any(a is None for a in [a2, a3, angle]): raise ValueError('a2, a3, and angle must not be None') # If not provided, set mask to the last atom in the angle description if mask is None and indices is None: mask = np.zeros(len(self)) mask[a3] = 1 elif indices is not None: mask = [index in indices for index in range(len(self))] if add: diff = angle else: # Compute necessary in angle change, from current value diff = angle - self.get_angle(a1, a2, a3) diff *= pi / 180 # Do rotation of subgroup by copying it to temporary atoms object and # then rotating that v10 = self.positions[a1] - self.positions[a2] v12 = self.positions[a3] - self.positions[a2] v10 /= np.linalg.norm(v10) v12 /= np.linalg.norm(v12) axis = np.cross(v10, v12) center = self.positions[a2] self._masked_rotate(center, axis, diff, mask)
[docs] def rattle(self, stdev=0.001, seed=None, rng=None): """Randomly displace atoms. This method adds random displacements to the atomic positions, taking a possible constraint into account. The random numbers are drawn from a normal distribution of standard deviation stdev. By default, the random number generator always uses the same seed (42) for repeatability. You can provide your own seed (an integer), or if you want the randomness to be different each time you run a script, then provide `rng=numpy.random`. For a parallel calculation, it is important to use the same seed on all processors! """ if seed is not None and rng is not None: raise ValueError('Please do not provide both seed and rng.') if rng is None: if seed is None: seed = 42 rng = np.random.RandomState(seed) positions = self.arrays['positions'] self.set_positions(positions + rng.normal(scale=stdev, size=positions.shape))
[docs] def get_distance(self, a0, a1, mic=False, vector=False): """Return distance between two atoms. Use mic=True to use the Minimum Image Convention. vector=True gives the distance vector (from a0 to a1). """ return self.get_distances(a0, [a1], mic=mic, vector=vector)[0]
[docs] def get_distances(self, a, indices, mic=False, vector=False): """Return distances of atom No.i with a list of atoms. Use mic=True to use the Minimum Image Convention. vector=True gives the distance vector (from a to self[indices]). """ from ase.geometry import get_distances R = self.arrays['positions'] p1 = [R[a]] p2 = R[indices] cell = None pbc = None if mic: cell = self.cell pbc = self.pbc D, D_len = get_distances(p1, p2, cell=cell, pbc=pbc) if vector: D.shape = (-1, 3) return D else: D_len.shape = (-1,) return D_len
[docs] def get_all_distances(self, mic=False, vector=False): """Return distances of all of the atoms with all of the atoms. Use mic=True to use the Minimum Image Convention. """ from ase.geometry import get_distances R = self.arrays['positions'] cell = None pbc = None if mic: cell = self.cell pbc = self.pbc D, D_len = get_distances(R, cell=cell, pbc=pbc) if vector: return D else: return D_len
[docs] def set_distance(self, a0, a1, distance, fix=0.5, mic=False, mask=None, indices=None, add=False, factor=False): """Set the distance between two atoms. Set the distance between atoms *a0* and *a1* to *distance*. By default, the center of the two atoms will be fixed. Use *fix=0* to fix the first atom, *fix=1* to fix the second atom and *fix=0.5* (default) to fix the center of the bond. If *mask* or *indices* are set (*mask* overwrites *indices*), only the atoms defined there are moved (see :meth:`ase.Atoms.set_dihedral`). When *add* is true, the distance is changed by the value given. In combination with *factor* True, the value given is a factor scaling the distance. It is assumed that the atoms in *mask*/*indices* move together with *a1*. If *fix=1*, only *a0* will therefore be moved.""" from ase.geometry import find_mic if a0 % len(self) == a1 % len(self): raise ValueError('a0 and a1 must not be the same') if add: oldDist = self.get_distance(a0, a1, mic=mic) if factor: newDist = oldDist * distance else: newDist = oldDist + distance self.set_distance(a0, a1, newDist, fix=fix, mic=mic, mask=mask, indices=indices, add=False, factor=False) return R = self.arrays['positions'] D = np.array([R[a1] - R[a0]]) if mic: D, D_len = find_mic(D, self.cell, self.pbc) else: D_len = np.array([np.sqrt((D**2).sum())]) x = 1.0 - distance / D_len[0] if mask is None and indices is None: indices = [a0, a1] elif mask: indices = [i for i in range(len(self)) if mask[i]] for i in indices: if i == a0: R[a0] += (x * fix) * D[0] else: R[i] -= (x * (1.0 - fix)) * D[0]
[docs] def get_scaled_positions(self, wrap=True): """Get positions relative to unit cell. If wrap is True, atoms outside the unit cell will be wrapped into the cell in those directions with periodic boundary conditions so that the scaled coordinates are between zero and one. If any cell vectors are zero, the corresponding coordinates are evaluated as if the cell were completed using ``cell.complete()``. This means coordinates will be Cartesian as long as the non-zero cell vectors span a Cartesian axis or plane.""" fractional = self.cell.scaled_positions(self.positions) if wrap: for i, periodic in enumerate(self.pbc): if periodic: # Yes, we need to do it twice. # See the scaled_positions.py test. fractional[:, i] %= 1.0 fractional[:, i] %= 1.0 return fractional
[docs] def set_scaled_positions(self, scaled): """Set positions relative to unit cell.""" self.positions[:] = self.cell.cartesian_positions(scaled)
[docs] def wrap(self, **wrap_kw): """Wrap positions to unit cell. Parameters: wrap_kw: (keyword=value) pairs optional keywords `pbc`, `center`, `pretty_translation`, `eps`, see :func:`ase.geometry.wrap_positions` """ if 'pbc' not in wrap_kw: wrap_kw['pbc'] = self.pbc self.positions[:] = self.get_positions(wrap=True, **wrap_kw)
[docs] def get_temperature(self): """Get the temperature in Kelvin.""" ekin = self.get_kinetic_energy() return 2 * ekin / (self.get_number_of_degrees_of_freedom() * units.kB)
def __eq__(self, other): """Check for identity of two atoms objects. Identity means: same positions, atomic numbers, unit cell and periodic boundary conditions.""" if not isinstance(other, Atoms): return False a = self.arrays b = other.arrays return (len(self) == len(other) and (a['positions'] == b['positions']).all() and (a['numbers'] == b['numbers']).all() and (self.cell == other.cell).all() and (self.pbc == other.pbc).all()) def __ne__(self, other): """Check if two atoms objects are not equal. Any differences in positions, atomic numbers, unit cell or periodic boundary condtions make atoms objects not equal. """ eq = self.__eq__(other) if eq is NotImplemented: return eq else: return not eq # @deprecated('Please use atoms.cell.volume') # We kind of want to deprecate this, but the ValueError behaviour # might be desirable. Should we do this?
[docs] def get_volume(self): """Get volume of unit cell.""" if self.cell.rank != 3: raise ValueError( 'You have {} lattice vectors: volume not defined' .format(self.cell.rank)) return self.cell.volume
@property def cell(self): """The :class:`ase.cell.Cell` for direct manipulation.""" return self._cellobj @cell.setter def cell(self, cell): cell = Cell.ascell(cell) self._cellobj[:] = cell
[docs] def write(self, filename, format=None, **kwargs): """Write atoms object to a file. see ase.io.write for formats. kwargs are passed to ase.io.write. """ from ase.io import write write(filename, self, format, **kwargs)
def iterimages(self): yield self def __ase_optimizable__(self): from ase.optimize.optimize import OptimizableAtoms return OptimizableAtoms(self)
[docs] def edit(self): """Modify atoms interactively through ASE's GUI viewer. Conflicts leading to undesirable behaviour might arise when matplotlib has been pre-imported with certain incompatible backends and while trying to use the plot feature inside the interactive GUI. To circumvent, please set matplotlib.use('gtk') before calling this method. """ from ase.gui.gui import GUI from ase.gui.images import Images images = Images([self]) gui = GUI(images) gui.run()
def string2vector(v): if isinstance(v, str): if v[0] == '-': return -string2vector(v[1:]) w = np.zeros(3) w['xyz'.index(v)] = 1.0 return w return np.array(v, float) def default(data, dflt): """Helper function for setting default values.""" if data is None: return None elif isinstance(data, (list, tuple)): newdata = [] allnone = True for x in data: if x is None: newdata.append(dflt) else: newdata.append(x) allnone = False if allnone: return None return newdata else: return data